C19H21BO6S — CID 170805330
S-[3-(1,3-dioxo-2-benzofuran-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170805330) has the molecular formula C19H21BO6S and a molecular weight of 388.25 g/mol. Its IUPAC name is S-[3-(1,3-dioxo-2-benzofuran-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(1,3-dioxo-2-benzofuran-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170805330 |
| Molecular Formula | C19H21BO6S |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | S-[3-(1,3-dioxo-2-benzofuran-5-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1ccc2c(c1)C(=O)OC2=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H21BO6S/c1-11(21)27-10-13(20-25-18(2,3)19(4,5)26-20)8-12-6-7-14-15(9-12)17(23)24-16(14)22/h6-9H,10H2,1-5H3 |
| InChIKey | YSEKKYDTHWZROM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|