C18H25BO4S — CID 170804314
S-[3-(4-hydroxy-3-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170804314) has the molecular formula C18H25BO4S and a molecular weight of 348.27 g/mol. Its IUPAC name is S-[3-(4-hydroxy-3-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(4-hydroxy-3-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170804314 |
| Molecular Formula | C18H25BO4S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | S-[3-(4-hydroxy-3-methylphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1ccc(O)c(C)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H25BO4S/c1-12-9-14(7-8-16(12)21)10-15(11-24-13(2)20)19-22-17(3,4)18(5,6)23-19/h7-10,21H,11H2,1-6H3 |
| InChIKey | DNEIEWPXKCFAPV-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|