C18H24BBrO4S — CID 170805668
S-[3-[4-bromo-3-(hydroxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170805668) has the molecular formula C18H24BBrO4S and a molecular weight of 427.17 g/mol. Its IUPAC name is S-[3-[4-bromo-3-(hydroxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-[4-bromo-3-(hydroxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170805668 |
| Molecular Formula | C18H24BBrO4S |
| Molecular Weight | 427.17 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | S-[3-[4-bromo-3-(hydroxymethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1ccc(Br)c(CO)c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H24BBrO4S/c1-12(22)25-11-15(19-23-17(2,3)18(4,5)24-19)9-13-6-7-16(20)14(8-13)10-21/h6-9,21H,10-11H2,1-5H3 |
| InChIKey | RDWDTJAVQOVELY-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|