C20H30BNO3S — CID 170805083
S-[3-[3-(ethylaminomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170805083) has the molecular formula C20H30BNO3S and a molecular weight of 375.34 g/mol. Its IUPAC name is S-[3-[3-(ethylaminomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-[3-(ethylaminomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170805083 |
| Molecular Formula | C20H30BNO3S |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | S-[3-[3-(ethylaminomethyl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CCNCc1cccc(C=C(CSC(C)=O)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C20H30BNO3S/c1-7-22-13-17-10-8-9-16(11-17)12-18(14-26-15(2)23)21-24-19(3,4)20(5,6)25-21/h8-12,22H,7,13-14H2,1-6H3 |
| InChIKey | QZYWXEISKZNQLH-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|