C20H23BClNO3S — CID 170805349
S-[3-(2-chloroquinolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170805349) has the molecular formula C20H23BClNO3S and a molecular weight of 403.74 g/mol. Its IUPAC name is S-[3-(2-chloroquinolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(2-chloroquinolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170805349 |
| Molecular Formula | C20H23BClNO3S |
| Molecular Weight | 403.74 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | S-[3-(2-chloroquinolin-6-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1ccc2nc(Cl)ccc2c1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H23BClNO3S/c1-13(24)27-12-16(21-25-19(2,3)20(4,5)26-21)11-14-6-8-17-15(10-14)7-9-18(22)23-17/h6-11H,12H2,1-5H3 |
| InChIKey | NCXFERJRNQKGDD-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.74 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|