C20H27BO6S — CID 170805476
2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-methoxyphenyl]acetic acid (PubChem CID 170805476) has the molecular formula C20H27BO6S and a molecular weight of 406.31 g/mol. Its IUPAC name is 2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 170805476 |
| Molecular Formula | C20H27BO6S |
| Molecular Weight | 406.31 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | 2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)c(C=C(CSC(C)=O)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C20H27BO6S/c1-13(22)28-12-16(21-26-19(2,3)20(4,5)27-21)9-15-10-17(25-6)8-7-14(15)11-18(23)24/h7-10H,11-12H2,1-6H3,(H,23,24) |
| InChIKey | UAYPLJNWPHWZJY-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|