C18H26BNO4S — CID 170804818
S-[3-(4-amino-2-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170804818) has the molecular formula C18H26BNO4S and a molecular weight of 363.29 g/mol. Its IUPAC name is S-[3-(4-amino-2-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(4-amino-2-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170804818 |
| Molecular Formula | C18H26BNO4S |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | S-[3-(4-amino-2-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | COc1cc(N)ccc1C=C(CSC(C)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H26BNO4S/c1-12(21)25-11-14(19-23-17(2,3)18(4,5)24-19)9-13-7-8-15(20)10-16(13)22-6/h7-10H,11,20H2,1-6H3 |
| InChIKey | URCUYEKWFVZNCL-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|