C18H24BNO5S — CID 170805125
2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-6-aminobenzoic acid (PubChem CID 170805125) has the molecular formula C18H24BNO5S and a molecular weight of 377.27 g/mol. Its IUPAC name is 2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-6-aminobenzoic acid.
| Compound Name | 2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-6-aminobenzoic acid |
|---|---|
| PubChem CID | 170805125 |
| Molecular Formula | C18H24BNO5S |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | 2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-6-aminobenzoic acid |
| SMILES | CC(=O)SCC(=Cc1cccc(N)c1C(=O)O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H24BNO5S/c1-11(21)26-10-13(19-24-17(2,3)18(4,5)25-19)9-12-7-6-8-14(20)15(12)16(22)23/h6-9H,10,20H2,1-5H3,(H,22,23) |
| InChIKey | HEYXZHYWMZZXRN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|