C19H26BNO4S — CID 170805131
S-[3-(2-acetamidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170805131) has the molecular formula C19H26BNO4S and a molecular weight of 375.30 g/mol. Its IUPAC name is S-[3-(2-acetamidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(2-acetamidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170805131 |
| Molecular Formula | C19H26BNO4S |
| Molecular Weight | 375.30 g/mol |
| Exact Mass | 375.17 |
| IUPAC Name | S-[3-(2-acetamidophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)Nc1ccccc1C=C(CSC(C)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H26BNO4S/c1-13(22)21-17-10-8-7-9-15(17)11-16(12-26-14(2)23)20-24-18(3,4)19(5,6)25-20/h7-11H,12H2,1-6H3,(H,21,22) |
| InChIKey | WSKNGGLAKJOPID-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|