C22H25BO5S — CID 170805524
5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]naphthalene-1-carboxylic acid (PubChem CID 170805524) has the molecular formula C22H25BO5S and a molecular weight of 412.32 g/mol. Its IUPAC name is 5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]naphthalene-1-carboxylic acid.
| Compound Name | 5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 170805524 |
| Molecular Formula | C22H25BO5S |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]naphthalene-1-carboxylic acid |
| SMILES | CC(=O)SCC(=Cc1cccc2c(C(=O)O)cccc12)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C22H25BO5S/c1-14(24)29-13-16(23-27-21(2,3)22(4,5)28-23)12-15-8-6-10-18-17(15)9-7-11-19(18)20(25)26/h6-12H,13H2,1-5H3,(H,25,26) |
| InChIKey | GPAZPXGPDZZKLK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|