C18H23BO7S — CID 170805170
5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,4-dihydroxybenzoic acid (PubChem CID 170805170) has the molecular formula C18H23BO7S and a molecular weight of 394.25 g/mol. Its IUPAC name is 5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,4-dihydroxybenzoic acid.
| Compound Name | 5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 170805170 |
| Molecular Formula | C18H23BO7S |
| Molecular Weight | 394.25 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | 5-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2,4-dihydroxybenzoic acid |
| SMILES | CC(=O)SCC(=Cc1cc(C(=O)O)c(O)cc1O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H23BO7S/c1-10(20)27-9-12(19-25-17(2,3)18(4,5)26-19)6-11-7-13(16(23)24)15(22)8-14(11)21/h6-8,21-22H,9H2,1-5H3,(H,23,24) |
| InChIKey | XCXZBHWGQFHXFY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.25 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|