C19H24BClO5S — CID 170805178
2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-chlorophenyl]acetic acid (PubChem CID 170805178) has the molecular formula C19H24BClO5S and a molecular weight of 410.73 g/mol. Its IUPAC name is 2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-chlorophenyl]acetic acid.
| Compound Name | 2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-chlorophenyl]acetic acid |
|---|---|
| PubChem CID | 170805178 |
| Molecular Formula | C19H24BClO5S |
| Molecular Weight | 410.73 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-chlorophenyl]acetic acid |
| SMILES | CC(=O)SCC(=Cc1cc(Cl)ccc1CC(=O)O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H24BClO5S/c1-12(22)27-11-15(20-25-18(2,3)19(4,5)26-20)8-14-9-16(21)7-6-13(14)10-17(23)24/h6-9H,10-11H2,1-5H3,(H,23,24) |
| InChIKey | FCBKVEZRXQRNRT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.73 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|