C19H25BO5S — CID 170804996
2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetic acid (PubChem CID 170804996) has the molecular formula C19H25BO5S and a molecular weight of 376.28 g/mol. Its IUPAC name is 2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetic acid.
| Compound Name | 2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 170804996 |
| Molecular Formula | C19H25BO5S |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | 2-[2-[3-acetylsulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetic acid |
| SMILES | CC(=O)SCC(=Cc1ccccc1CC(=O)O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C19H25BO5S/c1-13(21)26-12-16(20-24-18(2,3)19(4,5)25-20)10-14-8-6-7-9-15(14)11-17(22)23/h6-10H,11-12H2,1-5H3,(H,22,23) |
| InChIKey | PAZBXKMJSVOKGQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|