C18H24BClO4S — CID 170804589
S-[3-(4-chloro-2-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170804589) has the molecular formula C18H24BClO4S and a molecular weight of 382.72 g/mol. Its IUPAC name is S-[3-(4-chloro-2-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(4-chloro-2-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170804589 |
| Molecular Formula | C18H24BClO4S |
| Molecular Weight | 382.72 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | S-[3-(4-chloro-2-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | COc1cc(Cl)ccc1C=C(CSC(C)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H24BClO4S/c1-12(21)25-11-14(19-23-17(2,3)18(4,5)24-19)9-13-7-8-15(20)10-16(13)22-6/h7-10H,11H2,1-6H3 |
| InChIKey | WNYQIAZVMHOLSF-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.72 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|