C20H29BO6S — CID 170805469
S-[3-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170805469) has the molecular formula C20H29BO6S and a molecular weight of 408.33 g/mol. Its IUPAC name is S-[3-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170805469 |
| Molecular Formula | C20H29BO6S |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | S-[3-[4-(hydroxymethyl)-2,6-dimethoxyphenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | COc1cc(CO)cc(OC)c1C=C(CSC(C)=O)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C20H29BO6S/c1-13(23)28-12-15(21-26-19(2,3)20(4,5)27-21)10-16-17(24-6)8-14(11-22)9-18(16)25-7/h8-10,22H,11-12H2,1-7H3 |
| InChIKey | WTFCBYUCMVOKRS-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|