C17H24BNO4S — CID 170804477
S-[3-[4-(hydroxymethyl)-2-pyridinyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170804477) has the molecular formula C17H24BNO4S and a molecular weight of 349.26 g/mol. Its IUPAC name is S-[3-[4-(hydroxymethyl)-2-pyridinyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-[4-(hydroxymethyl)-2-pyridinyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170804477 |
| Molecular Formula | C17H24BNO4S |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | S-[3-[4-(hydroxymethyl)-2-pyridinyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1cc(CO)ccn1)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H24BNO4S/c1-12(21)24-11-14(9-15-8-13(10-20)6-7-19-15)18-22-16(2,3)17(4,5)23-18/h6-9,20H,10-11H2,1-5H3 |
| InChIKey | ISKKPOHRFHAMPO-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|