C17H23BClNO3S — CID 170804417
S-[3-(2-chloro-4-methyl-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170804417) has the molecular formula C17H23BClNO3S and a molecular weight of 367.71 g/mol. Its IUPAC name is S-[3-(2-chloro-4-methyl-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(2-chloro-4-methyl-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170804417 |
| Molecular Formula | C17H23BClNO3S |
| Molecular Weight | 367.71 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | S-[3-(2-chloro-4-methyl-3-pyridinyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1c(C)ccnc1Cl)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H23BClNO3S/c1-11-7-8-20-15(19)14(11)9-13(10-24-12(2)21)18-22-16(3,4)17(5,6)23-18/h7-9H,10H2,1-6H3 |
| InChIKey | NMTSOQQHGPNUFU-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.71 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|