C15H24BN3O3S — CID 170804215
S-[3-(5-amino-1-methylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate (PubChem CID 170804215) has the molecular formula C15H24BN3O3S and a molecular weight of 337.25 g/mol. Its IUPAC name is S-[3-(5-amino-1-methylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate.
| Compound Name | S-[3-(5-amino-1-methylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170804215 |
| Molecular Formula | C15H24BN3O3S |
| Molecular Weight | 337.25 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | S-[3-(5-amino-1-methylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1cnn(C)c1N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H24BN3O3S/c1-10(20)23-9-12(7-11-8-18-19(6)13(11)17)16-21-14(2,3)15(4,5)22-16/h7-8H,9,17H2,1-6H3 |
| InChIKey | SXBKBGNYRGPYAD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|