C15H20BF3N2O3S — CID 170804659
S-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-enyl] ethanethioate (PubChem CID 170804659) has the molecular formula C15H20BF3N2O3S and a molecular weight of 376.21 g/mol. Its IUPAC name is S-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-enyl] ethanethioate.
| Compound Name | S-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-enyl] ethanethioate |
|---|---|
| PubChem CID | 170804659 |
| Molecular Formula | C15H20BF3N2O3S |
| Molecular Weight | 376.21 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | S-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-enyl] ethanethioate |
| SMILES | CC(=O)SCC(=Cc1cn[nH]c1C(F)(F)F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H20BF3N2O3S/c1-9(22)25-8-11(16-23-13(2,3)14(4,5)24-16)6-10-7-20-21-12(10)15(17,18)19/h6-7H,8H2,1-5H3,(H,20,21) |
| InChIKey | STEQKMVGGNDODX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 64.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|