C15H21BF3N3O3 — CID 170807917
N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-enyl]acetamide (PubChem CID 170807917) has the molecular formula C15H21BF3N3O3 and a molecular weight of 359.16 g/mol. Its IUPAC name is N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-enyl]acetamide.
| Compound Name | N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807917 |
| Molecular Formula | C15H21BF3N3O3 |
| Molecular Weight | 359.16 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | N-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-[5-(trifluoromethyl)-1H-pyrazol-4-yl]prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cn[nH]c1C(F)(F)F)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C15H21BF3N3O3/c1-9(23)20-8-11(16-24-13(2,3)14(4,5)25-16)6-10-7-21-22-12(10)15(17,18)19/h6-7H,8H2,1-5H3,(H,20,23)(H,21,22) |
| InChIKey | MGLLRUOVTXEWCX-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.16 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|