C16H26BN3O3 — CID 170807405
N-[3-(1,3-dimethylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170807405) has the molecular formula C16H26BN3O3 and a molecular weight of 319.21 g/mol. Its IUPAC name is N-[3-(1,3-dimethylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(1,3-dimethylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170807405 |
| Molecular Formula | C16H26BN3O3 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-[3-(1,3-dimethylpyrazol-4-yl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cn(C)nc1C)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C16H26BN3O3/c1-11-13(10-20(7)19-11)8-14(9-18-12(2)21)17-22-15(3,4)16(5,6)23-17/h8,10H,9H2,1-7H3,(H,18,21) |
| InChIKey | GHIYOHHJGATPQP-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|