C17H23BF2N2O3 — CID 170808017
N-[3-(2-amino-4,5-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide (PubChem CID 170808017) has the molecular formula C17H23BF2N2O3 and a molecular weight of 352.19 g/mol. Its IUPAC name is N-[3-(2-amino-4,5-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide.
| Compound Name | N-[3-(2-amino-4,5-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
|---|---|
| PubChem CID | 170808017 |
| Molecular Formula | C17H23BF2N2O3 |
| Molecular Weight | 352.19 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[3-(2-amino-4,5-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]acetamide |
| SMILES | CC(=O)NCC(=Cc1cc(F)c(F)cc1N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H23BF2N2O3/c1-10(23)22-9-12(18-24-16(2,3)17(4,5)25-18)6-11-7-13(19)14(20)8-15(11)21/h6-8H,9,21H2,1-5H3,(H,22,23) |
| InChIKey | UPASNHSAJQLAHZ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.19 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|