C19H27BN2O5 — CID 170808544
methyl 3-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-aminobenzoate (PubChem CID 170808544) has the molecular formula C19H27BN2O5 and a molecular weight of 374.25 g/mol. Its IUPAC name is methyl 3-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-aminobenzoate.
| Compound Name | methyl 3-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-aminobenzoate |
|---|---|
| PubChem CID | 170808544 |
| Molecular Formula | C19H27BN2O5 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | methyl 3-[3-acetamido-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-aminobenzoate |
| SMILES | COC(=O)c1ccc(N)c(C=C(CNC(C)=O)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C19H27BN2O5/c1-12(23)22-11-15(20-26-18(2,3)19(4,5)27-20)10-14-9-13(17(24)25-6)7-8-16(14)21/h7-10H,11,21H2,1-6H3,(H,22,23) |
| InChIKey | JQUOACRQGNACOE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|