C17H24BNO5 — CID 170802029
methyl 3-amino-4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate (PubChem CID 170802029) has the molecular formula C17H24BNO5 and a molecular weight of 333.19 g/mol. Its IUPAC name is methyl 3-amino-4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate.
| Compound Name | methyl 3-amino-4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate |
|---|---|
| PubChem CID | 170802029 |
| Molecular Formula | C17H24BNO5 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | methyl 3-amino-4-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C(CO)B2OC(C)(C)C(C)(C)O2)c(N)c1 |
| InChI | InChI=1S/C17H24BNO5/c1-16(2)17(3,4)24-18(23-16)13(10-20)8-11-6-7-12(9-14(11)19)15(21)22-5/h6-9,20H,10,19H2,1-5H3 |
| InChIKey | CTVMYDUDVOMTFF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|