C18H26BNO4 — CID 170806835
methyl 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-methylbenzoate (PubChem CID 170806835) has the molecular formula C18H26BNO4 and a molecular weight of 331.22 g/mol. Its IUPAC name is methyl 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-methylbenzoate.
| Compound Name | methyl 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-methylbenzoate |
|---|---|
| PubChem CID | 170806835 |
| Molecular Formula | C18H26BNO4 |
| Molecular Weight | 331.22 g/mol |
| Exact Mass | 331.20 |
| IUPAC Name | methyl 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-methylbenzoate |
| SMILES | COC(=O)c1ccc(C=C(CN)B2OC(C)(C)C(C)(C)O2)c(C)c1 |
| InChI | InChI=1S/C18H26BNO4/c1-12-9-14(16(21)22-6)8-7-13(12)10-15(11-20)19-23-17(2,3)18(4,5)24-19/h7-10H,11,20H2,1-6H3 |
| InChIKey | NXNICSBVQYWFNL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.22 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|