C17H22BNO6 — CID 170807058
2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]terephthalic acid (PubChem CID 170807058) has the molecular formula C17H22BNO6 and a molecular weight of 347.18 g/mol. Its IUPAC name is 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]terephthalic acid.
| Compound Name | 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]terephthalic acid |
|---|---|
| PubChem CID | 170807058 |
| Molecular Formula | C17H22BNO6 |
| Molecular Weight | 347.18 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]terephthalic acid |
| SMILES | CC1(C)OB(C(=Cc2cc(C(=O)O)ccc2C(=O)O)CN)OC1(C)C |
| InChI | InChI=1S/C17H22BNO6/c1-16(2)17(3,4)25-18(24-16)12(9-19)8-11-7-10(14(20)21)5-6-13(11)15(22)23/h5-8H,9,19H2,1-4H3,(H,20,21)(H,22,23) |
| InChIKey | NYOVYFHYORXIBP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 119.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.18 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|