C17H24BNO5 — CID 170806867
2-[3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-hydroxyphenyl]acetic acid (PubChem CID 170806867) has the molecular formula C17H24BNO5 and a molecular weight of 333.19 g/mol. Its IUPAC name is 2-[3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-hydroxyphenyl]acetic acid.
| Compound Name | 2-[3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-hydroxyphenyl]acetic acid |
|---|---|
| PubChem CID | 170806867 |
| Molecular Formula | C17H24BNO5 |
| Molecular Weight | 333.19 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | 2-[3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-hydroxyphenyl]acetic acid |
| SMILES | CC1(C)OB(C(=Cc2cc(CC(=O)O)ccc2O)CN)OC1(C)C |
| InChI | InChI=1S/C17H24BNO5/c1-16(2)17(3,4)24-18(23-16)13(10-19)9-12-7-11(8-15(21)22)5-6-14(12)20/h5-7,9,20H,8,10,19H2,1-4H3,(H,21,22) |
| InChIKey | LNCIEZMWYQYFMT-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.19 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|