C16H21BFNO3 — CID 170806211
2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-fluorobenzaldehyde (PubChem CID 170806211) has the molecular formula C16H21BFNO3 and a molecular weight of 305.16 g/mol. Its IUPAC name is 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-fluorobenzaldehyde.
| Compound Name | 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-fluorobenzaldehyde |
|---|---|
| PubChem CID | 170806211 |
| Molecular Formula | C16H21BFNO3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | 2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-fluorobenzaldehyde |
| SMILES | CC1(C)OB(C(=Cc2cc(F)ccc2C=O)CN)OC1(C)C |
| InChI | InChI=1S/C16H21BFNO3/c1-15(2)16(3,4)22-17(21-15)13(9-19)7-12-8-14(18)6-5-11(12)10-20/h5-8,10H,9,19H2,1-4H3 |
| InChIKey | IMSASPILLKRSLQ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|