C15H22BFN2O2 — CID 170806022
4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-fluoroaniline (PubChem CID 170806022) has the molecular formula C15H22BFN2O2 and a molecular weight of 292.16 g/mol. Its IUPAC name is 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-fluoroaniline.
| Compound Name | 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-fluoroaniline |
|---|---|
| PubChem CID | 170806022 |
| Molecular Formula | C15H22BFN2O2 |
| Molecular Weight | 292.16 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-fluoroaniline |
| SMILES | CC1(C)OB(C(=Cc2ccc(N)cc2F)CN)OC1(C)C |
| InChI | InChI=1S/C15H22BFN2O2/c1-14(2)15(3,4)21-16(20-14)11(9-18)7-10-5-6-12(19)8-13(10)17/h5-8H,9,18-19H2,1-4H3 |
| InChIKey | ZCZCAHVFLQPNGU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.16 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|