C15H22BFN2O4S — CID 170806923
4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-fluorobenzenesulfonamide (PubChem CID 170806923) has the molecular formula C15H22BFN2O4S and a molecular weight of 356.23 g/mol. Its IUPAC name is 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-fluorobenzenesulfonamide.
| Compound Name | 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 170806923 |
| Molecular Formula | C15H22BFN2O4S |
| Molecular Weight | 356.23 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 4-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-3-fluorobenzenesulfonamide |
| SMILES | CC1(C)OB(C(=Cc2ccc(S(N)(=O)=O)cc2F)CN)OC1(C)C |
| InChI | InChI=1S/C15H22BFN2O4S/c1-14(2)15(3,4)23-16(22-14)11(9-18)7-10-5-6-12(8-13(10)17)24(19,20)21/h5-8H,9,18H2,1-4H3,(H2,19,20,21) |
| InChIKey | AFIIPKLWZRVTOI-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.23 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|