C15H19BBrF2NO2 — CID 170807287
3-(4-bromo-2,6-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine (PubChem CID 170807287) has the molecular formula C15H19BBrF2NO2 and a molecular weight of 374.03 g/mol. Its IUPAC name is 3-(4-bromo-2,6-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine.
| Compound Name | 3-(4-bromo-2,6-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 170807287 |
| Molecular Formula | C15H19BBrF2NO2 |
| Molecular Weight | 374.03 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 3-(4-bromo-2,6-difluorophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-amine |
| SMILES | CC1(C)OB(C(=Cc2c(F)cc(Br)cc2F)CN)OC1(C)C |
| InChI | InChI=1S/C15H19BBrF2NO2/c1-14(2)15(3,4)22-16(21-14)9(8-20)5-11-12(18)6-10(17)7-13(11)19/h5-7H,8,20H2,1-4H3 |
| InChIKey | ZWFJULALMQORAD-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.03 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|