C16H22BN3O2 — CID 170806307
4-amino-2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile (PubChem CID 170806307) has the molecular formula C16H22BN3O2 and a molecular weight of 299.18 g/mol. Its IUPAC name is 4-amino-2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile.
| Compound Name | 4-amino-2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 170806307 |
| Molecular Formula | C16H22BN3O2 |
| Molecular Weight | 299.18 g/mol |
| Exact Mass | 299.18 |
| IUPAC Name | 4-amino-2-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile |
| SMILES | CC1(C)OB(C(=Cc2cc(N)ccc2C#N)CN)OC1(C)C |
| InChI | InChI=1S/C16H22BN3O2/c1-15(2)16(3,4)22-17(21-15)13(10-19)7-12-8-14(20)6-5-11(12)9-18/h5-8H,10,19-20H2,1-4H3 |
| InChIKey | KMNFKSYOICLRNG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 94.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.18 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|