C17H24BN3O2 — CID 170814452
4-amino-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile (PubChem CID 170814452) has the molecular formula C17H24BN3O2 and a molecular weight of 313.21 g/mol. Its IUPAC name is 4-amino-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile.
| Compound Name | 4-amino-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 170814452 |
| Molecular Formula | C17H24BN3O2 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 4-amino-2-[3-(methylamino)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]benzonitrile |
| SMILES | CNCC(=Cc1cc(N)ccc1C#N)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H24BN3O2/c1-16(2)17(3,4)23-18(22-16)14(11-21-5)8-13-9-15(20)7-6-12(13)10-19/h6-9,21H,11,20H2,1-5H3 |
| InChIKey | BDDPABXLCHZOMY-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 80.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|