C15H19BClN3O2 — CID 170806290
5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-chloropyridine-3-carbonitrile (PubChem CID 170806290) has the molecular formula C15H19BClN3O2 and a molecular weight of 319.60 g/mol. Its IUPAC name is 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-chloropyridine-3-carbonitrile.
| Compound Name | 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-chloropyridine-3-carbonitrile |
|---|---|
| PubChem CID | 170806290 |
| Molecular Formula | C15H19BClN3O2 |
| Molecular Weight | 319.60 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 5-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-2-chloropyridine-3-carbonitrile |
| SMILES | CC1(C)OB(C(=Cc2cnc(Cl)c(C#N)c2)CN)OC1(C)C |
| InChI | InChI=1S/C15H19BClN3O2/c1-14(2)15(3,4)22-16(21-14)12(8-19)6-10-5-11(7-18)13(17)20-9-10/h5-6,9H,8,19H2,1-4H3 |
| InChIKey | FPVASRZDIMCHFD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.60 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|