C18H25BO6 — CID 170802213
2-[3-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-methoxyphenyl]acetic acid (PubChem CID 170802213) has the molecular formula C18H25BO6 and a molecular weight of 348.20 g/mol. Its IUPAC name is 2-[3-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-methoxyphenyl]acetic acid.
| Compound Name | 2-[3-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-methoxyphenyl]acetic acid |
|---|---|
| PubChem CID | 170802213 |
| Molecular Formula | C18H25BO6 |
| Molecular Weight | 348.20 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 2-[3-[3-hydroxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]-4-methoxyphenyl]acetic acid |
| SMILES | COc1ccc(CC(=O)O)cc1C=C(CO)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C18H25BO6/c1-17(2)18(3,4)25-19(24-17)14(11-20)10-13-8-12(9-16(21)22)6-7-15(13)23-5/h6-8,10,20H,9,11H2,1-5H3,(H,21,22) |
| InChIKey | JRFCONCNRMOCGS-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.20 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|