C17H25BO4S — CID 170803349
[4-methoxy-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]methanol (PubChem CID 170803349) has the molecular formula C17H25BO4S and a molecular weight of 336.26 g/mol. Its IUPAC name is [4-methoxy-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]methanol.
| Compound Name | [4-methoxy-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]methanol |
|---|---|
| PubChem CID | 170803349 |
| Molecular Formula | C17H25BO4S |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | [4-methoxy-3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]methanol |
| SMILES | COc1ccc(CO)cc1C=C(CS)B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C17H25BO4S/c1-16(2)17(3,4)22-18(21-16)14(11-23)9-13-8-12(10-19)6-7-15(13)20-5/h6-9,19,23H,10-11H2,1-5H3 |
| InChIKey | BJMYWDPSELPJSU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|