C16H23BO3S — CID 170802700
3-(3-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol (PubChem CID 170802700) has the molecular formula C16H23BO3S and a molecular weight of 306.24 g/mol. Its IUPAC name is 3-(3-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol.
| Compound Name | 3-(3-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
|---|---|
| PubChem CID | 170802700 |
| Molecular Formula | C16H23BO3S |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3-(3-methoxyphenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-ene-1-thiol |
| SMILES | COc1cccc(C=C(CS)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C16H23BO3S/c1-15(2)16(3,4)20-17(19-15)13(11-21)9-12-7-6-8-14(10-12)18-5/h6-10,21H,11H2,1-5H3 |
| InChIKey | KQWHSDPRPNLIQU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 27.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|