C18H25BO4S — CID 170803575
methyl 2-[3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetate (PubChem CID 170803575) has the molecular formula C18H25BO4S and a molecular weight of 348.27 g/mol. Its IUPAC name is methyl 2-[3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetate.
| Compound Name | methyl 2-[3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetate |
|---|---|
| PubChem CID | 170803575 |
| Molecular Formula | C18H25BO4S |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | methyl 2-[3-[3-sulfanyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]acetate |
| SMILES | COC(=O)Cc1cccc(C=C(CS)B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C18H25BO4S/c1-17(2)18(3,4)23-19(22-17)15(12-24)10-13-7-6-8-14(9-13)11-16(20)21-5/h6-10,24H,11-12H2,1-5H3 |
| InChIKey | KNIPMAAGTQNEQE-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|