C17H26BNO3 — CID 170806270
2-[3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanol (PubChem CID 170806270) has the molecular formula C17H26BNO3 and a molecular weight of 303.21 g/mol. Its IUPAC name is 2-[3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanol.
| Compound Name | 2-[3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanol |
|---|---|
| PubChem CID | 170806270 |
| Molecular Formula | C17H26BNO3 |
| Molecular Weight | 303.21 g/mol |
| Exact Mass | 303.20 |
| IUPAC Name | 2-[3-[3-amino-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-1-enyl]phenyl]ethanol |
| SMILES | CC1(C)OB(C(=Cc2cccc(CCO)c2)CN)OC1(C)C |
| InChI | InChI=1S/C17H26BNO3/c1-16(2)17(3,4)22-18(21-16)15(12-19)11-14-7-5-6-13(10-14)8-9-20/h5-7,10-11,20H,8-9,12,19H2,1-4H3 |
| InChIKey | SURYPZCDCSFXFC-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.21 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|