C15H20BBrO3 — CID 170802337
3-(3-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170802337) has the molecular formula C15H20BBrO3 and a molecular weight of 339.04 g/mol. Its IUPAC name is 3-(3-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-(3-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170802337 |
| Molecular Formula | C15H20BBrO3 |
| Molecular Weight | 339.04 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | 3-(3-bromophenyl)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | CC1(C)OB(C(=Cc2cccc(Br)c2)CO)OC1(C)C |
| InChI | InChI=1S/C15H20BBrO3/c1-14(2)15(3,4)20-16(19-14)12(10-18)8-11-6-5-7-13(17)9-11/h5-9,18H,10H2,1-4H3 |
| InChIKey | PQPZYRXZNVGJCP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.04 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|