C18H26BNO5S — CID 170802277
3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol (PubChem CID 170802277) has the molecular formula C18H26BNO5S and a molecular weight of 379.29 g/mol. Its IUPAC name is 3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol.
| Compound Name | 3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
|---|---|
| PubChem CID | 170802277 |
| Molecular Formula | C18H26BNO5S |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-en-1-ol |
| SMILES | CC1(C)OB(C(=Cc2cccc(N3CCCS3(=O)=O)c2)CO)OC1(C)C |
| InChI | InChI=1S/C18H26BNO5S/c1-17(2)18(3,4)25-19(24-17)15(13-21)11-14-7-5-8-16(12-14)20-9-6-10-26(20,22)23/h5,7-8,11-12,21H,6,9-10,13H2,1-4H3 |
| InChIKey | ZEGRGGPYEXTWHU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|