C33H37BN2O6S — CID 170812051
9H-fluoren-9-ylmethyl N-[3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate (PubChem CID 170812051) has the molecular formula C33H37BN2O6S and a molecular weight of 600.55 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
|---|---|
| PubChem CID | 170812051 |
| Molecular Formula | C33H37BN2O6S |
| Molecular Weight | 600.55 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[3-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enyl]carbamate |
| SMILES | CC1(C)OB(C(=Cc2cccc(N3CCCS3(=O)=O)c2)CNC(=O)OCC2c3ccccc3-c3ccccc32)OC1(C)C |
| InChI | InChI=1S/C33H37BN2O6S/c1-32(2)33(3,4)42-34(41-32)24(19-23-11-9-12-25(20-23)36-17-10-18-43(36,38)39)21-35-31(37)40-22-30-28-15-7-5-13-26(28)27-14-6-8-16-29(27)30/h5-9,11-16,19-20,30H,10,17-18,21-22H2,1-4H3,(H,35,37) |
| InChIKey | BPACZNPLUYXFOH-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.55 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|