C13H17NO2S2 — CID 170479280
4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]but-3-ene-1-thiol (PubChem CID 170479280) has the molecular formula C13H17NO2S2 and a molecular weight of 283.42 g/mol. Its IUPAC name is 4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]but-3-ene-1-thiol.
| Compound Name | 4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]but-3-ene-1-thiol |
|---|---|
| PubChem CID | 170479280 |
| Molecular Formula | C13H17NO2S2 |
| Molecular Weight | 283.42 g/mol |
| Exact Mass | 283.07 |
| IUPAC Name | 4-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]but-3-ene-1-thiol |
| SMILES | O=S1(=O)CCCN1c1cccc(C=CCCS)c1 |
| InChI | InChI=1S/C13H17NO2S2/c15-18(16)10-4-8-14(18)13-7-3-6-12(11-13)5-1-2-9-17/h1,3,5-7,11,17H,2,4,8-10H2 |
| InChIKey | JCRMABIDHDDLTG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.42 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|