C10H15N3O2S — CID 82084710
[3-(1,1-dioxothiazinan-2-yl)phenyl]hydrazine (PubChem CID 82084710) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is [3-(1,1-dioxothiazinan-2-yl)phenyl]hydrazine.
| Compound Name | [3-(1,1-dioxothiazinan-2-yl)phenyl]hydrazine |
|---|---|
| PubChem CID | 82084710 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | [3-(1,1-dioxothiazinan-2-yl)phenyl]hydrazine |
| SMILES | NNc1cccc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C10H15N3O2S/c11-12-9-4-3-5-10(8-9)13-6-1-2-7-16(13,14)15/h3-5,8,12H,1-2,6-7,11H2 |
| InChIKey | LWQSDLVEOBDDLS-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|