C14H16N2O4S3 — CID 112505540
N-[3-(1,1-dioxothiazinan-2-yl)phenyl]thiophene-2-sulfonamide (PubChem CID 112505540) has the molecular formula C14H16N2O4S3 and a molecular weight of 372.49 g/mol. Its IUPAC name is N-[3-(1,1-dioxothiazinan-2-yl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(1,1-dioxothiazinan-2-yl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 112505540 |
| Molecular Formula | C14H16N2O4S3 |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.03 |
| IUPAC Name | N-[3-(1,1-dioxothiazinan-2-yl)phenyl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(Nc1cccc(N2CCCCS2(=O)=O)c1)c1cccs1 |
| InChI | InChI=1S/C14H16N2O4S3/c17-22(18)10-2-1-8-16(22)13-6-3-5-12(11-13)15-23(19,20)14-7-4-9-21-14/h3-7,9,11,15H,1-2,8,10H2 |
| InChIKey | KMVDEJBWGDEQRJ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |