C11H17N3O4S2 — CID 110621354
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(ethylsulfamoyl)aniline (PubChem CID 110621354) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(ethylsulfamoyl)aniline.
| Compound Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(ethylsulfamoyl)aniline |
|---|---|
| PubChem CID | 110621354 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(ethylsulfamoyl)aniline |
| SMILES | CCNS(=O)(=O)Nc1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C11H17N3O4S2/c1-2-12-20(17,18)13-10-5-3-6-11(9-10)14-7-4-8-19(14,15)16/h3,5-6,9,12-13H,2,4,7-8H2,1H3 |
| InChIKey | CEKFUCKNRMLUAZ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |