C14H20N2O4S2 — CID 110302255
N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]cyclopentanesulfonamide (PubChem CID 110302255) has the molecular formula C14H20N2O4S2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]cyclopentanesulfonamide.
| Compound Name | N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]cyclopentanesulfonamide |
|---|---|
| PubChem CID | 110302255 |
| Molecular Formula | C14H20N2O4S2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]cyclopentanesulfonamide |
| SMILES | O=S(=O)(Nc1cccc(N2CCCS2(=O)=O)c1)C1CCCC1 |
| InChI | InChI=1S/C14H20N2O4S2/c17-21(18)10-4-9-16(21)13-6-3-5-12(11-13)15-22(19,20)14-7-1-2-8-14/h3,5-6,11,14-15H,1-2,4,7-10H2 |
| InChIKey | HOSDPSHGHZNZJM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |