C12H18N2O4S2 — CID 7635594
N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]propane-2-sulfonamide (PubChem CID 7635594) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]propane-2-sulfonamide.
| Compound Name | N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]propane-2-sulfonamide |
|---|---|
| PubChem CID | 7635594 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]propane-2-sulfonamide |
| SMILES | CC(C)S(=O)(=O)Nc1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C12H18N2O4S2/c1-10(2)20(17,18)13-11-5-3-6-12(9-11)14-7-4-8-19(14,15)16/h3,5-6,9-10,13H,4,7-8H2,1-2H3 |
| InChIKey | OMDRTZOYJZLPSJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |