C12H17N3O3S — CID 119289907
(2R)-2-amino-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]propanamide (PubChem CID 119289907) has the molecular formula C12H17N3O3S and a molecular weight of 283.35 g/mol. Its IUPAC name is (2R)-2-amino-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]propanamide.
| Compound Name | (2R)-2-amino-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 119289907 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (2R)-2-amino-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]propanamide |
| SMILES | C[C@@H](N)C(=O)Nc1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C12H17N3O3S/c1-9(13)12(16)14-10-4-2-5-11(8-10)15-6-3-7-19(15,17)18/h2,4-5,8-9H,3,6-7,13H2,1H3,(H,14,16)/t9-/m1/s1 |
| InChIKey | WLJWEWJIXLOPHN-SECBINFHSA-N |
| XLogP | 0.51 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |