C13H19N3O3S — CID 22690097
4-amino-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]butanamide (PubChem CID 22690097) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is 4-amino-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]butanamide.
| Compound Name | 4-amino-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 22690097 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 4-amino-N-[3-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]butanamide |
| SMILES | NCCCC(=O)Nc1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C13H19N3O3S/c14-7-2-6-13(17)15-11-4-1-5-12(10-11)16-8-3-9-20(16,18)19/h1,4-5,10H,2-3,6-9,14H2,(H,15,17) |
| InChIKey | OIIVSRKZGKCIKP-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |